C22H26N2O — CID 54147834
N-(5-amino-1,2,3,4-tetrahydronaphthalen-2-yl)-N-(3-phenylprop-2-enyl)propanamide (PubChem CID 54147834) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is N-(5-amino-1,2,3,4-tetrahydronaphthalen-2-yl)-N-(3-phenylprop-2-enyl)propanamide.
| Compound Name | N-(5-amino-1,2,3,4-tetrahydronaphthalen-2-yl)-N-(3-phenylprop-2-enyl)propanamide |
|---|---|
| PubChem CID | 54147834 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-(5-amino-1,2,3,4-tetrahydronaphthalen-2-yl)-N-(3-phenylprop-2-enyl)propanamide |
| SMILES | CCC(=O)N(CC=Cc1ccccc1)C1CCc2c(N)cccc2C1 |
| InChI | InChI=1S/C22H26N2O/c1-2-22(25)24(15-7-10-17-8-4-3-5-9-17)19-13-14-20-18(16-19)11-6-12-21(20)23/h3-12,19H,2,13-16,23H2,1H3 |
| InChIKey | OFQCFXKOQIQJQA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|