C19H23N3OS2 — CID 141078127
(5R)-5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one (PubChem CID 141078127) has the molecular formula C19H23N3OS2 and a molecular weight of 373.55 g/mol. Its IUPAC name is (5R)-5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141078127 |
| Molecular Formula | C19H23N3OS2 |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (5R)-5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](CNC2CCc3ccccc32)N1CCSc1nccs1 |
| InChI | InChI=1S/C19H23N3OS2/c23-18-8-6-15(22(18)10-12-25-19-20-9-11-24-19)13-21-17-7-5-14-3-1-2-4-16(14)17/h1-4,9,11,15,17,21H,5-8,10,12-13H2/t15-,17?/m1/s1 |
| InChIKey | AQVSQJMNXOCPEN-LDCVWXEPSA-N |
| XLogP | 3.50 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|