C16H18BrN3OS2 — CID 141078147
(5R)-5-[(3-bromoanilino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one (PubChem CID 141078147) has the molecular formula C16H18BrN3OS2 and a molecular weight of 412.38 g/mol. Its IUPAC name is (5R)-5-[(3-bromoanilino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(3-bromoanilino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141078147 |
| Molecular Formula | C16H18BrN3OS2 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | (5R)-5-[(3-bromoanilino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](CNc2cccc(Br)c2)N1CCSc1nccs1 |
| InChI | InChI=1S/C16H18BrN3OS2/c17-12-2-1-3-13(10-12)19-11-14-4-5-15(21)20(14)7-9-23-16-18-6-8-22-16/h1-3,6,8,10,14,19H,4-5,7,9,11H2/t14-/m1/s1 |
| InChIKey | SWISVRIBYWYDQY-CQSZACIVSA-N |
| XLogP | 4.10 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|