C16H19FN2O4 — CID 141079035
[2-(4-fluoro-2-methylphenyl)-3-(oxomethylidene)piperidin-4-yl] N-(2-hydroxyethyl)carbamate (PubChem CID 141079035) has the molecular formula C16H19FN2O4 and a molecular weight of 322.34 g/mol. Its IUPAC name is [2-(4-fluoro-2-methylphenyl)-3-(oxomethylidene)piperidin-4-yl] N-(2-hydroxyethyl)carbamate.
| Compound Name | [2-(4-fluoro-2-methylphenyl)-3-(oxomethylidene)piperidin-4-yl] N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 141079035 |
| Molecular Formula | C16H19FN2O4 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [2-(4-fluoro-2-methylphenyl)-3-(oxomethylidene)piperidin-4-yl] N-(2-hydroxyethyl)carbamate |
| SMILES | Cc1cc(F)ccc1C1NCCC(OC(=O)NCCO)C1=C=O |
| InChI | InChI=1S/C16H19FN2O4/c1-10-8-11(17)2-3-12(10)15-13(9-21)14(4-5-18-15)23-16(22)19-6-7-20/h2-3,8,14-15,18,20H,4-7H2,1H3,(H,19,22) |
| InChIKey | BDDRNJPQOMNPAJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|