C19H26F3NO2 — CID 141080634
3-cyclopentyloxy-2-[[4-(trifluoromethoxy)phenyl]methyl]cyclohexan-1-amine (PubChem CID 141080634) has the molecular formula C19H26F3NO2 and a molecular weight of 357.42 g/mol. Its IUPAC name is 3-cyclopentyloxy-2-[[4-(trifluoromethoxy)phenyl]methyl]cyclohexan-1-amine.
| Compound Name | 3-cyclopentyloxy-2-[[4-(trifluoromethoxy)phenyl]methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 141080634 |
| Molecular Formula | C19H26F3NO2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 3-cyclopentyloxy-2-[[4-(trifluoromethoxy)phenyl]methyl]cyclohexan-1-amine |
| SMILES | NC1CCCC(OC2CCCC2)C1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H26F3NO2/c20-19(21,22)25-15-10-8-13(9-11-15)12-16-17(23)6-3-7-18(16)24-14-4-1-2-5-14/h8-11,14,16-18H,1-7,12,23H2 |
| InChIKey | GWEDPONWCPIYLH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |