C20H23ClO4 — CID 141081108
4-(7-chloro-2,4-dihydro-1-benzofuran-2-yl)-5-methoxy-2,3,3,6-tetramethylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 141081108) has the molecular formula C20H23ClO4 and a molecular weight of 362.85 g/mol. Its IUPAC name is 4-(7-chloro-2,4-dihydro-1-benzofuran-2-yl)-5-methoxy-2,3,3,6-tetramethylcyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 4-(7-chloro-2,4-dihydro-1-benzofuran-2-yl)-5-methoxy-2,3,3,6-tetramethylcyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 141081108 |
| Molecular Formula | C20H23ClO4 |
| Molecular Weight | 362.85 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 4-(7-chloro-2,4-dihydro-1-benzofuran-2-yl)-5-methoxy-2,3,3,6-tetramethylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | COC1=C(C)C(C(=O)O)=C(C)C(C)(C)C1C1C=C2CC=CC(Cl)=C2O1 |
| InChI | InChI=1S/C20H23ClO4/c1-10-15(19(22)23)11(2)20(3,4)16(17(10)24-5)14-9-12-7-6-8-13(21)18(12)25-14/h6,8-9,14,16H,7H2,1-5H3,(H,22,23) |
| InChIKey | BVYIFVWGKOCHMN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.85 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |