C24H30O4 — CID 71588363
5-hydroxy-2,2-dimethyl-7,10-bis(2-methylbut-3-en-2-yl)-9a,10-dihydropyrano[3,2-g]chromen-8-one (PubChem CID 71588363) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 5-hydroxy-2,2-dimethyl-7,10-bis(2-methylbut-3-en-2-yl)-9a,10-dihydropyrano[3,2-g]chromen-8-one.
| Compound Name | 5-hydroxy-2,2-dimethyl-7,10-bis(2-methylbut-3-en-2-yl)-9a,10-dihydropyrano[3,2-g]chromen-8-one |
|---|---|
| PubChem CID | 71588363 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 5-hydroxy-2,2-dimethyl-7,10-bis(2-methylbut-3-en-2-yl)-9a,10-dihydropyrano[3,2-g]chromen-8-one |
| SMILES | C=CC(C)(C)C1=CC2=C(O)C3=C(OC(C)(C)C=C3)C(C(C)(C)C=C)C2OC1=O |
| InChI | InChI=1S/C24H30O4/c1-9-22(3,4)16-13-15-18(25)14-11-12-24(7,8)28-20(14)17(23(5,6)10-2)19(15)27-21(16)26/h9-13,17,19,25H,1-2H2,3-8H3 |
| InChIKey | TXYNUNIBVFHMGB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|