C8H11O2PS2Zn — CID 141081758
zinc (1,6-dimethylcyclohexa-2,4-dien-1-yl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane (PubChem CID 141081758) has the molecular formula C8H11O2PS2Zn and a molecular weight of 299.67 g/mol. Its IUPAC name is zinc (1,6-dimethylcyclohexa-2,4-dien-1-yl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane.
| Compound Name | zinc (1,6-dimethylcyclohexa-2,4-dien-1-yl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 141081758 |
| Molecular Formula | C8H11O2PS2Zn |
| Molecular Weight | 299.67 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | zinc (1,6-dimethylcyclohexa-2,4-dien-1-yl)sulfanyl-dioxido-sulfanylidene-λ5-phosphane |
| SMILES | CC1C=CC=CC1(C)SP([O-])([O-])=S.[Zn+2] |
| InChI | InChI=1S/C8H13O2PS2.Zn/c1-7-5-3-4-6-8(7,2)13-11(9,10)12;/h3-7H,1-2H3,(H2,9,10,12);/q;+2/p-2 |
| InChIKey | UGMUNKYEZHCQKM-UHFFFAOYSA-L |
| XLogP | 1.18 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.67 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|