C11H12N2 — CID 141319549
5-(diisocyanomethyl)-5,6-dimethylcyclohexa-1,3-diene (PubChem CID 141319549) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 5-(diisocyanomethyl)-5,6-dimethylcyclohexa-1,3-diene.
| Compound Name | 5-(diisocyanomethyl)-5,6-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141319549 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 5-(diisocyanomethyl)-5,6-dimethylcyclohexa-1,3-diene |
| SMILES | [C-]#[N+]C([N+]#[C-])C1(C)C=CC=CC1C |
| InChI | InChI=1S/C11H12N2/c1-9-7-5-6-8-11(9,2)10(12-3)13-4/h5-10H,1-2H3 |
| InChIKey | LQRCCSVZCLXLAE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|