C12H25N — CID 141081847
3-methyl-N,N-dipropylpent-3-en-1-amine (PubChem CID 141081847) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is 3-methyl-N,N-dipropylpent-3-en-1-amine.
| Compound Name | 3-methyl-N,N-dipropylpent-3-en-1-amine |
|---|---|
| PubChem CID | 141081847 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 3-methyl-N,N-dipropylpent-3-en-1-amine |
| SMILES | CC=C(C)CCN(CCC)CCC |
| InChI | InChI=1S/C12H25N/c1-5-9-13(10-6-2)11-8-12(4)7-3/h7H,5-6,8-11H2,1-4H3 |
| InChIKey | MOTPJOKHCLHEGH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|