C8H10O13 — CID 141081857
2-(1,2-dicarboxy-1,2-dihydroxyethoxy)-2,3-dihydroxybutanedioic acid (PubChem CID 141081857) has the molecular formula C8H10O13 and a molecular weight of 314.16 g/mol. Its IUPAC name is 2-(1,2-dicarboxy-1,2-dihydroxyethoxy)-2,3-dihydroxybutanedioic acid.
| Compound Name | 2-(1,2-dicarboxy-1,2-dihydroxyethoxy)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 141081857 |
| Molecular Formula | C8H10O13 |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-(1,2-dicarboxy-1,2-dihydroxyethoxy)-2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)C(O)C(O)(OC(O)(C(=O)O)C(O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H10O13/c9-1(3(11)12)7(19,5(15)16)21-8(20,6(17)18)2(10)4(13)14/h1-2,9-10,19-20H,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | LITGISQWPZLKGK-UHFFFAOYSA-N |
| XLogP | -4.56 |
| TPSA | 239.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|