C18H34O9 — CID 141083457
6-[6-ethoxy-5,5-bis(hydroxymethyl)-6-oxohexoxy]-2,2-bis(hydroxymethyl)hexanoic acid (PubChem CID 141083457) has the molecular formula C18H34O9 and a molecular weight of 394.46 g/mol. Its IUPAC name is 6-[6-ethoxy-5,5-bis(hydroxymethyl)-6-oxohexoxy]-2,2-bis(hydroxymethyl)hexanoic acid.
| Compound Name | 6-[6-ethoxy-5,5-bis(hydroxymethyl)-6-oxohexoxy]-2,2-bis(hydroxymethyl)hexanoic acid |
|---|---|
| PubChem CID | 141083457 |
| Molecular Formula | C18H34O9 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 6-[6-ethoxy-5,5-bis(hydroxymethyl)-6-oxohexoxy]-2,2-bis(hydroxymethyl)hexanoic acid |
| SMILES | CCOC(=O)C(CO)(CO)CCCCOCCCCC(CO)(CO)C(=O)O |
| InChI | InChI=1S/C18H34O9/c1-2-27-16(25)18(13-21,14-22)8-4-6-10-26-9-5-3-7-17(11-19,12-20)15(23)24/h19-22H,2-14H2,1H3,(H,23,24) |
| InChIKey | LBVDSVRGKNUKCO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|