C13H18O3 — CID 141084073
3,4-dihydro-2H-pyran-2-ylmethyl (3E)-2-methylhexa-3,5-dienoate (PubChem CID 141084073) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-2-ylmethyl (3E)-2-methylhexa-3,5-dienoate.
| Compound Name | 3,4-dihydro-2H-pyran-2-ylmethyl (3E)-2-methylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 141084073 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 3,4-dihydro-2H-pyran-2-ylmethyl (3E)-2-methylhexa-3,5-dienoate |
| SMILES | C=C/C=C/C(C)C(=O)OCC1CCC=CO1 |
| InChI | InChI=1S/C13H18O3/c1-3-4-7-11(2)13(14)16-10-12-8-5-6-9-15-12/h3-4,6-7,9,11-12H,1,5,8,10H2,2H3/b7-4+ |
| InChIKey | RBYLQOIHNHXICC-QPJJXVBHSA-N |
| XLogP | 2.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|