C17H16N6O2 — CID 141085525
1-piperazin-1-yl-2-(7-pyrazin-2-yl-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione (PubChem CID 141085525) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 1-piperazin-1-yl-2-(7-pyrazin-2-yl-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione.
| Compound Name | 1-piperazin-1-yl-2-(7-pyrazin-2-yl-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 141085525 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-piperazin-1-yl-2-(7-pyrazin-2-yl-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCNCC1)c1c[nH]c2c(-c3cnccn3)nccc12 |
| InChI | InChI=1S/C17H16N6O2/c24-16(17(25)23-7-5-18-6-8-23)12-9-22-14-11(12)1-2-21-15(14)13-10-19-3-4-20-13/h1-4,9-10,18,22H,5-8H2 |
| InChIKey | BYARXGUBBLBVQU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|