C19H18ClN5 — CID 141086325
N'-[3-(1H-benzimidazol-2-yl)-7-chloroquinolin-4-yl]-N-methylethane-1,2-diamine (PubChem CID 141086325) has the molecular formula C19H18ClN5 and a molecular weight of 351.84 g/mol. Its IUPAC name is N'-[3-(1H-benzimidazol-2-yl)-7-chloroquinolin-4-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[3-(1H-benzimidazol-2-yl)-7-chloroquinolin-4-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 141086325 |
| Molecular Formula | C19H18ClN5 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N'-[3-(1H-benzimidazol-2-yl)-7-chloroquinolin-4-yl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNc1c(-c2nc3ccccc3[nH]2)cnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H18ClN5/c1-21-8-9-22-18-13-7-6-12(20)10-17(13)23-11-14(18)19-24-15-4-2-3-5-16(15)25-19/h2-7,10-11,21H,8-9H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | HIAIIZDFVIIVHK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|