C19H28O2 — CID 141086710
(3S,7S,8S,10S,13S,14S)-10,13-dimethyl-2,3,4,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol (PubChem CID 141086710) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (3S,7S,8S,10S,13S,14S)-10,13-dimethyl-2,3,4,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (3S,7S,8S,10S,13S,14S)-10,13-dimethyl-2,3,4,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 141086710 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (3S,7S,8S,10S,13S,14S)-10,13-dimethyl-2,3,4,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| SMILES | C[C@]12CC[C@H](O)CC1=C[C@H](O)[C@@H]1C2=CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C19H28O2/c1-18-7-3-4-14(18)17-15(6-8-18)19(2)9-5-13(20)10-12(19)11-16(17)21/h6,11,13-14,16-17,20-21H,3-5,7-10H2,1-2H3/t13-,14-,16-,17-,18-,19-/m0/s1 |
| InChIKey | ILCSDEOILYZNHT-YQAXKJAASA-N |
| XLogP | 3.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|