C20H28O — CID 174882868
(8S,10S,13S,14S)-10,13-dimethyl-2,3,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carbaldehyde (PubChem CID 174882868) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (8S,10S,13S,14S)-10,13-dimethyl-2,3,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carbaldehyde.
| Compound Name | (8S,10S,13S,14S)-10,13-dimethyl-2,3,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carbaldehyde |
|---|---|
| PubChem CID | 174882868 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (8S,10S,13S,14S)-10,13-dimethyl-2,3,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carbaldehyde |
| SMILES | C[C@]12CCC(C=O)C=C1CC[C@@H]1C2=CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C20H28O/c1-19-9-3-4-17(19)16-6-5-15-12-14(13-21)7-11-20(15,2)18(16)8-10-19/h8,12-14,16-17H,3-7,9-11H2,1-2H3/t14?,16-,17-,19-,20-/m0/s1 |
| InChIKey | WZLSFRMIMFFNPM-RWLCCHIUSA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|