C21H26O3 — CID 628404
6,13-dimethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icosa-11,17-diene-8,16-dione (PubChem CID 628404) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 6,13-dimethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icosa-11,17-diene-8,16-dione.
| Compound Name | 6,13-dimethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icosa-11,17-diene-8,16-dione |
|---|---|
| PubChem CID | 628404 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 6,13-dimethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icosa-11,17-diene-8,16-dione |
| SMILES | CC1OC(=O)C23CC=C4C(CCC5=CC(=O)CCC54C)C2CCC13 |
| InChI | InChI=1S/C21H26O3/c1-12-16-5-6-18-15-4-3-13-11-14(22)7-9-20(13,2)17(15)8-10-21(16,18)19(23)24-12/h8,11-12,15-16,18H,3-7,9-10H2,1-2H3 |
| InChIKey | IKHUQIDIYUBXDL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|