C26H31FO — CID 174178210
(10S,13S,14S,17S)-17-(3-fluorophenyl)-10,13,17-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 174178210) has the molecular formula C26H31FO and a molecular weight of 378.53 g/mol. Its IUPAC name is (10S,13S,14S,17S)-17-(3-fluorophenyl)-10,13,17-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (10S,13S,14S,17S)-17-(3-fluorophenyl)-10,13,17-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 174178210 |
| Molecular Formula | C26H31FO |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (10S,13S,14S,17S)-17-(3-fluorophenyl)-10,13,17-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CCC1C2=CC[C@@]2(C)[C@H]1CC[C@]2(C)c1cccc(F)c1 |
| InChI | InChI=1S/C26H31FO/c1-24-12-9-20(28)16-17(24)7-8-21-22(24)10-14-26(3)23(21)11-13-25(26,2)18-5-4-6-19(27)15-18/h4-6,10,15-16,21,23H,7-9,11-14H2,1-3H3/t21?,23-,24-,25+,26-/m0/s1 |
| InChIKey | VDCZIFUMCYTWQL-VKVPZBPMSA-N |
| XLogP | 6.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|