C23H20Br2O2 — CID 141086933
4-(2,6-dibromophenoxy)-2-[(E)-2-phenylethenyl]-6-propan-2-ylphenol (PubChem CID 141086933) has the molecular formula C23H20Br2O2 and a molecular weight of 488.22 g/mol. Its IUPAC name is 4-(2,6-dibromophenoxy)-2-[(E)-2-phenylethenyl]-6-propan-2-ylphenol.
| Compound Name | 4-(2,6-dibromophenoxy)-2-[(E)-2-phenylethenyl]-6-propan-2-ylphenol |
|---|---|
| PubChem CID | 141086933 |
| Molecular Formula | C23H20Br2O2 |
| Molecular Weight | 488.22 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | 4-(2,6-dibromophenoxy)-2-[(E)-2-phenylethenyl]-6-propan-2-ylphenol |
| SMILES | CC(C)c1cc(Oc2c(Br)cccc2Br)cc(/C=C/c2ccccc2)c1O |
| InChI | InChI=1S/C23H20Br2O2/c1-15(2)19-14-18(27-23-20(24)9-6-10-21(23)25)13-17(22(19)26)12-11-16-7-4-3-5-8-16/h3-15,26H,1-2H3/b12-11+ |
| InChIKey | KWAZBHVNSSTAKK-VAWYXSNFSA-N |
| XLogP | 8.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.22 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|