C28H20F6O4 — CID 141087112
4-[4-[4-ethyl-2-[4-(4,4,4-trifluoro-2,3-dioxobutyl)phenyl]phenyl]phenyl]-1,1,1-trifluorobutane-2,3-dione (PubChem CID 141087112) has the molecular formula C28H20F6O4 and a molecular weight of 534.45 g/mol. Its IUPAC name is 4-[4-[4-ethyl-2-[4-(4,4,4-trifluoro-2,3-dioxobutyl)phenyl]phenyl]phenyl]-1,1,1-trifluorobutane-2,3-dione.
| Compound Name | 4-[4-[4-ethyl-2-[4-(4,4,4-trifluoro-2,3-dioxobutyl)phenyl]phenyl]phenyl]-1,1,1-trifluorobutane-2,3-dione |
|---|---|
| PubChem CID | 141087112 |
| Molecular Formula | C28H20F6O4 |
| Molecular Weight | 534.45 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 4-[4-[4-ethyl-2-[4-(4,4,4-trifluoro-2,3-dioxobutyl)phenyl]phenyl]phenyl]-1,1,1-trifluorobutane-2,3-dione |
| SMILES | CCc1ccc(-c2ccc(CC(=O)C(=O)C(F)(F)F)cc2)c(-c2ccc(CC(=O)C(=O)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C28H20F6O4/c1-2-16-7-12-21(19-8-3-17(4-9-19)14-23(35)25(37)27(29,30)31)22(13-16)20-10-5-18(6-11-20)15-24(36)26(38)28(32,33)34/h3-13H,2,14-15H2,1H3 |
| InChIKey | JVBURAZPIAQQBS-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.45 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|