C21H14F6O4 — CID 141087123
1,1,1-trifluoro-4-[4-[[4-(4,4,4-trifluoro-2,3-dioxobutyl)phenyl]methyl]phenyl]butane-2,3-dione (PubChem CID 141087123) has the molecular formula C21H14F6O4 and a molecular weight of 444.33 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-[4-[[4-(4,4,4-trifluoro-2,3-dioxobutyl)phenyl]methyl]phenyl]butane-2,3-dione.
| Compound Name | 1,1,1-trifluoro-4-[4-[[4-(4,4,4-trifluoro-2,3-dioxobutyl)phenyl]methyl]phenyl]butane-2,3-dione |
|---|---|
| PubChem CID | 141087123 |
| Molecular Formula | C21H14F6O4 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 1,1,1-trifluoro-4-[4-[[4-(4,4,4-trifluoro-2,3-dioxobutyl)phenyl]methyl]phenyl]butane-2,3-dione |
| SMILES | O=C(Cc1ccc(Cc2ccc(CC(=O)C(=O)C(F)(F)F)cc2)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C21H14F6O4/c22-20(23,24)18(30)16(28)10-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)11-17(29)19(31)21(25,26)27/h1-8H,9-11H2 |
| InChIKey | DAKWTSMRVWVDCO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|