C22H16F6O4 — CID 141087113
1,1,1-trifluoro-4-[4-[2-[4-(4,4,4-trifluoro-2,3-dioxobutyl)phenyl]ethyl]phenyl]butane-2,3-dione (PubChem CID 141087113) has the molecular formula C22H16F6O4 and a molecular weight of 458.35 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-[4-[2-[4-(4,4,4-trifluoro-2,3-dioxobutyl)phenyl]ethyl]phenyl]butane-2,3-dione.
| Compound Name | 1,1,1-trifluoro-4-[4-[2-[4-(4,4,4-trifluoro-2,3-dioxobutyl)phenyl]ethyl]phenyl]butane-2,3-dione |
|---|---|
| PubChem CID | 141087113 |
| Molecular Formula | C22H16F6O4 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 1,1,1-trifluoro-4-[4-[2-[4-(4,4,4-trifluoro-2,3-dioxobutyl)phenyl]ethyl]phenyl]butane-2,3-dione |
| SMILES | O=C(Cc1ccc(CCc2ccc(CC(=O)C(=O)C(F)(F)F)cc2)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C22H16F6O4/c23-21(24,25)19(31)17(29)11-15-7-3-13(4-8-15)1-2-14-5-9-16(10-6-14)12-18(30)20(32)22(26,27)28/h3-10H,1-2,11-12H2 |
| InChIKey | PHVRKNBHEDNPIG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|