C15H12ClF3O — CID 142461476
(3E)-1-(4-chlorophenyl)-3-(3,3,3-trifluoroprop-1-en-2-yl)hexa-3,5-dien-2-one (PubChem CID 142461476) has the molecular formula C15H12ClF3O and a molecular weight of 300.71 g/mol. Its IUPAC name is (3E)-1-(4-chlorophenyl)-3-(3,3,3-trifluoroprop-1-en-2-yl)hexa-3,5-dien-2-one.
| Compound Name | (3E)-1-(4-chlorophenyl)-3-(3,3,3-trifluoroprop-1-en-2-yl)hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 142461476 |
| Molecular Formula | C15H12ClF3O |
| Molecular Weight | 300.71 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | (3E)-1-(4-chlorophenyl)-3-(3,3,3-trifluoroprop-1-en-2-yl)hexa-3,5-dien-2-one |
| SMILES | C=C/C=C(\C(=C)C(F)(F)F)C(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12ClF3O/c1-3-4-13(10(2)15(17,18)19)14(20)9-11-5-7-12(16)8-6-11/h3-8H,1-2,9H2/b13-4+ |
| InChIKey | OLKMLEGHIGFWRB-YIXHJXPBSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.71 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|