C12H13F2NO — CID 141088156
3,3-difluoro-1-[(2-methyloxiran-2-yl)methyl]-2H-indole (PubChem CID 141088156) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is 3,3-difluoro-1-[(2-methyloxiran-2-yl)methyl]-2H-indole.
| Compound Name | 3,3-difluoro-1-[(2-methyloxiran-2-yl)methyl]-2H-indole |
|---|---|
| PubChem CID | 141088156 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3,3-difluoro-1-[(2-methyloxiran-2-yl)methyl]-2H-indole |
| SMILES | CC1(CN2CC(F)(F)c3ccccc32)CO1 |
| InChI | InChI=1S/C12H13F2NO/c1-11(8-16-11)6-15-7-12(13,14)9-4-2-3-5-10(9)15/h2-5H,6-8H2,1H3 |
| InChIKey | OECPDHKZHMIDNC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|