C16H25NO — CID 143386599
ethane;1,4',4'-trimethylspiro[2H-indole-3,3'-oxolane] (PubChem CID 143386599) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is ethane;1,4',4'-trimethylspiro[2H-indole-3,3'-oxolane].
| Compound Name | ethane;1,4',4'-trimethylspiro[2H-indole-3,3'-oxolane] |
|---|---|
| PubChem CID | 143386599 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | ethane;1,4',4'-trimethylspiro[2H-indole-3,3'-oxolane] |
| SMILES | CC.CN1CC2(COCC2(C)C)c2ccccc21 |
| InChI | InChI=1S/C14H19NO.C2H6/c1-13(2)9-16-10-14(13)8-15(3)12-7-5-4-6-11(12)14;1-2/h4-7H,8-10H2,1-3H3;1-2H3 |
| InChIKey | NGWXHIOPRRUYKC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |