C12H16N2O — CID 112545926
1-methylspiro[2H-indole-3,2'-morpholine] (PubChem CID 112545926) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-methylspiro[2H-indole-3,2'-morpholine].
| Compound Name | 1-methylspiro[2H-indole-3,2'-morpholine] |
|---|---|
| PubChem CID | 112545926 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-methylspiro[2H-indole-3,2'-morpholine] |
| SMILES | CN1CC2(CNCCO2)c2ccccc21 |
| InChI | InChI=1S/C12H16N2O/c1-14-9-12(8-13-6-7-15-12)10-4-2-3-5-11(10)14/h2-5,13H,6-9H2,1H3 |
| InChIKey | RFGITVKKJFZJDV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |