C11H13NO2 — CID 112545638
spiro[2H-1-benzofuran-3,2'-morpholine] (PubChem CID 112545638) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is spiro[2H-1-benzofuran-3,2'-morpholine].
| Compound Name | spiro[2H-1-benzofuran-3,2'-morpholine] |
|---|---|
| PubChem CID | 112545638 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | spiro[2H-1-benzofuran-3,2'-morpholine] |
| SMILES | c1ccc2c(c1)OCC21CNCCO1 |
| InChI | InChI=1S/C11H13NO2/c1-2-4-10-9(3-1)11(8-13-10)7-12-5-6-14-11/h1-4,12H,5-8H2 |
| InChIKey | ORGQCDNDBFWVFF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |