C14H18N4O2 — CID 141089733
1-[1-(4-methoxyphenyl)pyrazol-3-yl]-1,3,3-trimethylurea (PubChem CID 141089733) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)pyrazol-3-yl]-1,3,3-trimethylurea.
| Compound Name | 1-[1-(4-methoxyphenyl)pyrazol-3-yl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 141089733 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)pyrazol-3-yl]-1,3,3-trimethylurea |
| SMILES | COc1ccc(-n2ccc(N(C)C(=O)N(C)C)n2)cc1 |
| InChI | InChI=1S/C14H18N4O2/c1-16(2)14(19)17(3)13-9-10-18(15-13)11-5-7-12(20-4)8-6-11/h5-10H,1-4H3 |
| InChIKey | RPWWQDFFOXMANG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |