C23H28N6O4 — CID 21091141
1-[5-[4-[2-(carbamoylamino)ethoxy]phenyl]-1-(4-methoxyphenyl)pyrazol-3-yl]-1,3,3-trimethylurea (PubChem CID 21091141) has the molecular formula C23H28N6O4 and a molecular weight of 452.52 g/mol. Its IUPAC name is 1-[5-[4-[2-(carbamoylamino)ethoxy]phenyl]-1-(4-methoxyphenyl)pyrazol-3-yl]-1,3,3-trimethylurea.
| Compound Name | 1-[5-[4-[2-(carbamoylamino)ethoxy]phenyl]-1-(4-methoxyphenyl)pyrazol-3-yl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 21091141 |
| Molecular Formula | C23H28N6O4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1-[5-[4-[2-(carbamoylamino)ethoxy]phenyl]-1-(4-methoxyphenyl)pyrazol-3-yl]-1,3,3-trimethylurea |
| SMILES | COc1ccc(-n2nc(N(C)C(=O)N(C)C)cc2-c2ccc(OCCNC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C23H28N6O4/c1-27(2)23(31)28(3)21-15-20(29(26-21)17-7-11-18(32-4)12-8-17)16-5-9-19(10-6-16)33-14-13-25-22(24)30/h5-12,15H,13-14H2,1-4H3,(H3,24,25,30) |
| InChIKey | YQZLLRFTBQOXTJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|