C22H26N4O5 — CID 21091064
2-[4-[3-(2-methoxyethoxy)-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethylurea (PubChem CID 21091064) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-[4-[3-(2-methoxyethoxy)-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethylurea.
| Compound Name | 2-[4-[3-(2-methoxyethoxy)-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethylurea |
|---|---|
| PubChem CID | 21091064 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-[4-[3-(2-methoxyethoxy)-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethylurea |
| SMILES | COCCOc1cc(-c2ccc(OCCNC(N)=O)cc2)n(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C22H26N4O5/c1-28-13-14-31-21-15-20(26(25-21)17-5-9-18(29-2)10-6-17)16-3-7-19(8-4-16)30-12-11-24-22(23)27/h3-10,15H,11-14H2,1-2H3,(H3,23,24,27) |
| InChIKey | AUMNPIBJWQUXQR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|