C22H27N3O5S — CID 21091096
N-[2-[4-[1-(4-methoxyphenyl)-3-propan-2-yloxypyrazol-5-yl]phenoxy]ethyl]methanesulfonamide (PubChem CID 21091096) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is N-[2-[4-[1-(4-methoxyphenyl)-3-propan-2-yloxypyrazol-5-yl]phenoxy]ethyl]methanesulfonamide.
| Compound Name | N-[2-[4-[1-(4-methoxyphenyl)-3-propan-2-yloxypyrazol-5-yl]phenoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 21091096 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[2-[4-[1-(4-methoxyphenyl)-3-propan-2-yloxypyrazol-5-yl]phenoxy]ethyl]methanesulfonamide |
| SMILES | COc1ccc(-n2nc(OC(C)C)cc2-c2ccc(OCCNS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H27N3O5S/c1-16(2)30-22-15-21(25(24-22)18-7-11-19(28-3)12-8-18)17-5-9-20(10-6-17)29-14-13-23-31(4,26)27/h5-12,15-16,23H,13-14H2,1-4H3 |
| InChIKey | XQAUIFLVBANMNL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|