C19H20F2N4O4S — CID 21091079
N-[2-[4-[3-(difluoromethyl)-1-(6-methoxy-3-pyridinyl)pyrazol-5-yl]phenoxy]ethyl]methanesulfonamide (PubChem CID 21091079) has the molecular formula C19H20F2N4O4S and a molecular weight of 438.46 g/mol. Its IUPAC name is N-[2-[4-[3-(difluoromethyl)-1-(6-methoxy-3-pyridinyl)pyrazol-5-yl]phenoxy]ethyl]methanesulfonamide.
| Compound Name | N-[2-[4-[3-(difluoromethyl)-1-(6-methoxy-3-pyridinyl)pyrazol-5-yl]phenoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 21091079 |
| Molecular Formula | C19H20F2N4O4S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-[2-[4-[3-(difluoromethyl)-1-(6-methoxy-3-pyridinyl)pyrazol-5-yl]phenoxy]ethyl]methanesulfonamide |
| SMILES | COc1ccc(-n2nc(C(F)F)cc2-c2ccc(OCCNS(C)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C19H20F2N4O4S/c1-28-18-8-5-14(12-22-18)25-17(11-16(24-25)19(20)21)13-3-6-15(7-4-13)29-10-9-23-30(2,26)27/h3-8,11-12,19,23H,9-10H2,1-2H3 |
| InChIKey | CBBJWPPBEAHSEA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|