C21H25N5O4 — CID 21091099
2-[4-[1-(6-methoxy-3-pyridinyl)-3-propan-2-yloxypyrazol-5-yl]phenoxy]ethylurea (PubChem CID 21091099) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[4-[1-(6-methoxy-3-pyridinyl)-3-propan-2-yloxypyrazol-5-yl]phenoxy]ethylurea.
| Compound Name | 2-[4-[1-(6-methoxy-3-pyridinyl)-3-propan-2-yloxypyrazol-5-yl]phenoxy]ethylurea |
|---|---|
| PubChem CID | 21091099 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-[4-[1-(6-methoxy-3-pyridinyl)-3-propan-2-yloxypyrazol-5-yl]phenoxy]ethylurea |
| SMILES | COc1ccc(-n2nc(OC(C)C)cc2-c2ccc(OCCNC(N)=O)cc2)cn1 |
| InChI | InChI=1S/C21H25N5O4/c1-14(2)30-20-12-18(26(25-20)16-6-9-19(28-3)24-13-16)15-4-7-17(8-5-15)29-11-10-23-21(22)27/h4-9,12-14H,10-11H2,1-3H3,(H3,22,23,27) |
| InChIKey | ZQDAWKRWPOTDQU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|