C21H21N4O4- — CID 21090821
N-[2-[4-[1-(6-methoxy-3-pyridinyl)-3-prop-1-en-2-ylpyrazol-5-yl]phenoxy]ethyl]carbamate (PubChem CID 21090821) has the molecular formula C21H21N4O4- and a molecular weight of 393.42 g/mol. Its IUPAC name is N-[2-[4-[1-(6-methoxy-3-pyridinyl)-3-prop-1-en-2-ylpyrazol-5-yl]phenoxy]ethyl]carbamate.
| Compound Name | N-[2-[4-[1-(6-methoxy-3-pyridinyl)-3-prop-1-en-2-ylpyrazol-5-yl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 21090821 |
| Molecular Formula | C21H21N4O4- |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-[2-[4-[1-(6-methoxy-3-pyridinyl)-3-prop-1-en-2-ylpyrazol-5-yl]phenoxy]ethyl]carbamate |
| SMILES | C=C(C)c1cc(-c2ccc(OCCNC(=O)[O-])cc2)n(-c2ccc(OC)nc2)n1 |
| InChI | InChI=1S/C21H22N4O4/c1-14(2)18-12-19(25(24-18)16-6-9-20(28-3)23-13-16)15-4-7-17(8-5-15)29-11-10-22-21(26)27/h4-9,12-13,22H,1,10-11H2,2-3H3,(H,26,27)/p-1 |
| InChIKey | IIUOYXGKNLNWTK-UHFFFAOYSA-M |
| XLogP | 2.29 |
| TPSA | 101.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|