C26H32N4O6 — CID 58806700
tert-butyl N-[2-[4-[3-[methoxy(methyl)carbamoyl]-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethyl]carbamate (PubChem CID 58806700) has the molecular formula C26H32N4O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[3-[methoxy(methyl)carbamoyl]-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[3-[methoxy(methyl)carbamoyl]-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 58806700 |
| Molecular Formula | C26H32N4O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | tert-butyl N-[2-[4-[3-[methoxy(methyl)carbamoyl]-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethyl]carbamate |
| SMILES | COc1ccc(-n2nc(C(=O)N(C)OC)cc2-c2ccc(OCCNC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H32N4O6/c1-26(2,3)36-25(32)27-15-16-35-21-11-7-18(8-12-21)23-17-22(24(31)29(4)34-6)28-30(23)19-9-13-20(33-5)14-10-19/h7-14,17H,15-16H2,1-6H3,(H,27,32) |
| InChIKey | CGOCLRMOKBGRCF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|