C24H29N5O5 — CID 90687518
[4-[3-[methoxy(methyl)carbamoyl]-1-(6-methoxy-3-pyridinyl)pyrazol-5-yl]phenyl]methyl N-tert-butylcarbamate (PubChem CID 90687518) has the molecular formula C24H29N5O5 and a molecular weight of 467.53 g/mol. Its IUPAC name is [4-[3-[methoxy(methyl)carbamoyl]-1-(6-methoxy-3-pyridinyl)pyrazol-5-yl]phenyl]methyl N-tert-butylcarbamate.
| Compound Name | [4-[3-[methoxy(methyl)carbamoyl]-1-(6-methoxy-3-pyridinyl)pyrazol-5-yl]phenyl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90687518 |
| Molecular Formula | C24H29N5O5 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | [4-[3-[methoxy(methyl)carbamoyl]-1-(6-methoxy-3-pyridinyl)pyrazol-5-yl]phenyl]methyl N-tert-butylcarbamate |
| SMILES | COc1ccc(-n2nc(C(=O)N(C)OC)cc2-c2ccc(COC(=O)NC(C)(C)C)cc2)cn1 |
| InChI | InChI=1S/C24H29N5O5/c1-24(2,3)26-23(31)34-15-16-7-9-17(10-8-16)20-13-19(22(30)28(4)33-6)27-29(20)18-11-12-21(32-5)25-14-18/h7-14H,15H2,1-6H3,(H,26,31) |
| InChIKey | WBTCAQCUBPCHBH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|