C27H34N4O5 — CID 90712631
2-[4-[3-[ethyl(methyl)carbamoyl]-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethyl N-tert-butylcarbamate (PubChem CID 90712631) has the molecular formula C27H34N4O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is 2-[4-[3-[ethyl(methyl)carbamoyl]-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethyl N-tert-butylcarbamate.
| Compound Name | 2-[4-[3-[ethyl(methyl)carbamoyl]-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90712631 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 2-[4-[3-[ethyl(methyl)carbamoyl]-1-(4-methoxyphenyl)pyrazol-5-yl]phenoxy]ethyl N-tert-butylcarbamate |
| SMILES | CCN(C)C(=O)c1cc(-c2ccc(OCCOC(=O)NC(C)(C)C)cc2)n(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C27H34N4O5/c1-7-30(5)25(32)23-18-24(31(29-23)20-10-14-21(34-6)15-11-20)19-8-12-22(13-9-19)35-16-17-36-26(33)28-27(2,3)4/h8-15,18H,7,16-17H2,1-6H3,(H,28,33) |
| InChIKey | NYPUWLUNXUTADX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|