C20H21N5O5 — CID 21090964
[5-[4-[2-(carbamoylamino)ethoxy]phenyl]-1-(4-methoxyphenyl)pyrazol-3-yl]carbamic acid (PubChem CID 21090964) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is [5-[4-[2-(carbamoylamino)ethoxy]phenyl]-1-(4-methoxyphenyl)pyrazol-3-yl]carbamic acid.
| Compound Name | [5-[4-[2-(carbamoylamino)ethoxy]phenyl]-1-(4-methoxyphenyl)pyrazol-3-yl]carbamic acid |
|---|---|
| PubChem CID | 21090964 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [5-[4-[2-(carbamoylamino)ethoxy]phenyl]-1-(4-methoxyphenyl)pyrazol-3-yl]carbamic acid |
| SMILES | COc1ccc(-n2nc(NC(=O)O)cc2-c2ccc(OCCNC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C20H21N5O5/c1-29-15-8-4-14(5-9-15)25-17(12-18(24-25)23-20(27)28)13-2-6-16(7-3-13)30-11-10-22-19(21)26/h2-9,12H,10-11H2,1H3,(H,23,24)(H,27,28)(H3,21,22,26) |
| InChIKey | SYXJZKANRNSKPV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|