C23H27F3N2OS2 — CID 141090712
1-hexyl-1-(5-sulfanyl-2,3-dihydro-1H-inden-2-yl)-3-[4-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 141090712) has the molecular formula C23H27F3N2OS2 and a molecular weight of 468.61 g/mol. Its IUPAC name is 1-hexyl-1-(5-sulfanyl-2,3-dihydro-1H-inden-2-yl)-3-[4-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-hexyl-1-(5-sulfanyl-2,3-dihydro-1H-inden-2-yl)-3-[4-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 141090712 |
| Molecular Formula | C23H27F3N2OS2 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 1-hexyl-1-(5-sulfanyl-2,3-dihydro-1H-inden-2-yl)-3-[4-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | CCCCCCN(C(=O)Nc1ccc(SC(F)(F)F)cc1)C1Cc2ccc(S)cc2C1 |
| InChI | InChI=1S/C23H27F3N2OS2/c1-2-3-4-5-12-28(19-13-16-6-9-20(30)15-17(16)14-19)22(29)27-18-7-10-21(11-8-18)31-23(24,25)26/h6-11,15,19,30H,2-5,12-14H2,1H3,(H,27,29) |
| InChIKey | GFFJCJKBNKWRKB-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|