C36H46O5 — CID 141094053
5-[[2-[[2-(1,3-benzodioxol-5-ylmethyl)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]methyl]-1,3-benzodioxole (PubChem CID 141094053) has the molecular formula C36H46O5 and a molecular weight of 558.76 g/mol. Its IUPAC name is 5-[[2-[[2-(1,3-benzodioxol-5-ylmethyl)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]methyl]-1,3-benzodioxole.
| Compound Name | 5-[[2-[[2-(1,3-benzodioxol-5-ylmethyl)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 141094053 |
| Molecular Formula | C36H46O5 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | 5-[[2-[[2-(1,3-benzodioxol-5-ylmethyl)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]methyl]-1,3-benzodioxole |
| SMILES | CC12CCC(C1)C(C)(C)C2(Cc1ccc2c(c1)OCO2)OC1(Cc2ccc3c(c2)OCO3)C2(C)CCC(C2)C1(C)C |
| InChI | InChI=1S/C36H46O5/c1-31(2)25-11-13-33(5,19-25)35(31,17-23-7-9-27-29(15-23)39-21-37-27)41-36(32(3,4)26-12-14-34(36,6)20-26)18-24-8-10-28-30(16-24)40-22-38-28/h7-10,15-16,25-26H,11-14,17-22H2,1-6H3 |
| InChIKey | JNTAOGYEHOBEAC-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |