C22H24O6 — CID 163416461
(3R,4R)-3,4-bis(1,3-benzodioxol-5-ylmethyl)-3,4-dimethyloxolan-2-ol (PubChem CID 163416461) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is (3R,4R)-3,4-bis(1,3-benzodioxol-5-ylmethyl)-3,4-dimethyloxolan-2-ol.
| Compound Name | (3R,4R)-3,4-bis(1,3-benzodioxol-5-ylmethyl)-3,4-dimethyloxolan-2-ol |
|---|---|
| PubChem CID | 163416461 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (3R,4R)-3,4-bis(1,3-benzodioxol-5-ylmethyl)-3,4-dimethyloxolan-2-ol |
| SMILES | C[C@]1(Cc2ccc3c(c2)OCO3)COC(O)[C@]1(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H24O6/c1-21(9-14-3-5-16-18(7-14)27-12-25-16)11-24-20(23)22(21,2)10-15-4-6-17-19(8-15)28-13-26-17/h3-8,20,23H,9-13H2,1-2H3/t20?,21-,22-/m0/s1 |
| InChIKey | AEVGNQKOBCTDBT-QIFDKBNDSA-N |
| XLogP | 3.29 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |