C19H41NO3 — CID 141094810
azanium (2S)-2,3,3-tributyl-2-hydroxyheptanoate (PubChem CID 141094810) has the molecular formula C19H41NO3 and a molecular weight of 331.54 g/mol. Its IUPAC name is azanium (2S)-2,3,3-tributyl-2-hydroxyheptanoate.
| Compound Name | azanium (2S)-2,3,3-tributyl-2-hydroxyheptanoate |
|---|---|
| PubChem CID | 141094810 |
| Molecular Formula | C19H41NO3 |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.31 |
| IUPAC Name | azanium (2S)-2,3,3-tributyl-2-hydroxyheptanoate |
| SMILES | CCCCC(CCCC)(CCCC)[C@@](O)(CCCC)C(=O)[O-].[NH4+] |
| InChI | InChI=1S/C19H38O3.H3N/c1-5-9-13-18(14-10-6-2,15-11-7-3)19(22,17(20)21)16-12-8-4;/h22H,5-16H2,1-4H3,(H,20,21);1H3/t19-;/m1./s1 |
| InChIKey | LIEXTKMNNIKMCQ-FSRHSHDFSA-N |
| XLogP | 4.59 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |