C18H34O3Si — CID 141095036
5-[tert-butyl(dimethyl)silyl]oxy-2,2,4,6-tetramethyl-3-oxooct-7-enal (PubChem CID 141095036) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-2,2,4,6-tetramethyl-3-oxooct-7-enal.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-2,2,4,6-tetramethyl-3-oxooct-7-enal |
|---|---|
| PubChem CID | 141095036 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-2,2,4,6-tetramethyl-3-oxooct-7-enal |
| SMILES | C=CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(=O)C(C)(C)C=O |
| InChI | InChI=1S/C18H34O3Si/c1-11-13(2)15(21-22(9,10)17(4,5)6)14(3)16(20)18(7,8)12-19/h11-15H,1H2,2-10H3 |
| InChIKey | REGXEVFQGUZXRK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|