C15H20NO6P — CID 141096179
[4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl dihydrogen phosphate (PubChem CID 141096179) has the molecular formula C15H20NO6P and a molecular weight of 341.30 g/mol. Its IUPAC name is [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl dihydrogen phosphate.
| Compound Name | [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 141096179 |
| Molecular Formula | C15H20NO6P |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [4-[2-(4-acetylphenyl)ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl dihydrogen phosphate |
| SMILES | CC(=O)c1ccc(CCC2(COP(=O)(O)O)COC(C)=N2)cc1 |
| InChI | InChI=1S/C15H20NO6P/c1-11(17)14-5-3-13(4-6-14)7-8-15(9-21-12(2)16-15)10-22-23(18,19)20/h3-6H,7-10H2,1-2H3,(H2,18,19,20) |
| InChIKey | GNUKKPCIIKEIGS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|