C8H11NO3 — CID 141096346
1-hydroxy-1-azaspiro[4.4]nonane-2,4-dione (PubChem CID 141096346) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 1-hydroxy-1-azaspiro[4.4]nonane-2,4-dione.
| Compound Name | 1-hydroxy-1-azaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 141096346 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1-hydroxy-1-azaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1CC(=O)C2(CCCC2)N1O |
| InChI | InChI=1S/C8H11NO3/c10-6-5-7(11)9(12)8(6)3-1-2-4-8/h12H,1-5H2 |
| InChIKey | ZBWKVRNRDMGBDP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|