C20H19F3O2 — CID 141097992
2-ethyl-7-[(4-methoxyphenyl)methyl]-2-(trifluoromethyl)chromene (PubChem CID 141097992) has the molecular formula C20H19F3O2 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-ethyl-7-[(4-methoxyphenyl)methyl]-2-(trifluoromethyl)chromene.
| Compound Name | 2-ethyl-7-[(4-methoxyphenyl)methyl]-2-(trifluoromethyl)chromene |
|---|---|
| PubChem CID | 141097992 |
| Molecular Formula | C20H19F3O2 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-ethyl-7-[(4-methoxyphenyl)methyl]-2-(trifluoromethyl)chromene |
| SMILES | CCC1(C(F)(F)F)C=Cc2ccc(Cc3ccc(OC)cc3)cc2O1 |
| InChI | InChI=1S/C20H19F3O2/c1-3-19(20(21,22)23)11-10-16-7-4-15(13-18(16)25-19)12-14-5-8-17(24-2)9-6-14/h4-11,13H,3,12H2,1-2H3 |
| InChIKey | VVFAZABKZKBEPW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |