C22H22O2 — CID 58598667
4-[[4-(4-methoxyphenoxy)phenyl]methyl]-1,2-dimethylbenzene (PubChem CID 58598667) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[[4-(4-methoxyphenoxy)phenyl]methyl]-1,2-dimethylbenzene.
| Compound Name | 4-[[4-(4-methoxyphenoxy)phenyl]methyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 58598667 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-[[4-(4-methoxyphenoxy)phenyl]methyl]-1,2-dimethylbenzene |
| SMILES | COc1ccc(Oc2ccc(Cc3ccc(C)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C22H22O2/c1-16-4-5-19(14-17(16)2)15-18-6-8-21(9-7-18)24-22-12-10-20(23-3)11-13-22/h4-14H,15H2,1-3H3 |
| InChIKey | NZJLWJGTHJZAOO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |