C17H15ClN4O2 — CID 141099167
2-chloro-1-(1H-indazol-5-yl)-6,7-dimethoxy-2H-quinazoline (PubChem CID 141099167) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is 2-chloro-1-(1H-indazol-5-yl)-6,7-dimethoxy-2H-quinazoline.
| Compound Name | 2-chloro-1-(1H-indazol-5-yl)-6,7-dimethoxy-2H-quinazoline |
|---|---|
| PubChem CID | 141099167 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-chloro-1-(1H-indazol-5-yl)-6,7-dimethoxy-2H-quinazoline |
| SMILES | COc1cc2c(cc1OC)N(c1ccc3[nH]ncc3c1)C(Cl)N=C2 |
| InChI | InChI=1S/C17H15ClN4O2/c1-23-15-6-11-8-19-17(18)22(14(11)7-16(15)24-2)12-3-4-13-10(5-12)9-20-21-13/h3-9,17H,1-2H3,(H,20,21) |
| InChIKey | JKXXORZAVFLCTK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|