C6H3FN2O — CID 141099453
2-fluoro-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 141099453) has the molecular formula C6H3FN2O and a molecular weight of 138.10 g/mol. Its IUPAC name is 2-fluoro-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 2-fluoro-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 141099453 |
| Molecular Formula | C6H3FN2O |
| Molecular Weight | 138.10 g/mol |
| Exact Mass | 138.02 |
| IUPAC Name | 2-fluoro-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Fc1nc2cccnc2o1 |
| InChI | InChI=1S/C6H3FN2O/c7-6-9-4-2-1-3-8-5(4)10-6/h1-3H |
| InChIKey | HPPAJNSXWGHLJS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.10 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |